Artemether
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-05656 |
| Alternative Name(s) | (3R,5aS,6R,8aS,9R,10S,12R,12aR)l-3,12-epoxy-12H-pyrano[4,3-j]-1,2-benzodioxepin;xy-3,6,9-trimethyl-3,12-epoxy-12H-pyrano[4,3-j]-1,2-benzodioxepin; Artemos; Artenam; Artesaph; Artesian; |
| Research Area | Derivative of Artemisinin . Antimalarial, used to treat strains of malaria which are multi-drug resistant. |
| Molecular Formula | C16H26O5 |
| CAS# | 71963-77-4 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@@H]1[C@@](CC[C@@H](C)[C@]2([H])CC[C@]3(C)O4)([H])[C@@]2(OO3)[C@]4([H])O[C@@H]1OC |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO05656.html |
| Additional Information | NULL |