Artemisinin
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-30484 |
| Alternative Name(s) | (3R,5aS,6R,8aS,9R,12S,12aRx12H-pyrano[4,3-j]-1,2-benzodioxepin-10(3H)-one; Artemisine; Arteannuin; Huanghuahaosu; (3R,5aS,6R,8aS,9R,12S,12aR)-3,6,9-trimethyloctahydro-3H-3,12-epoxy[1,2]dioxepino[4,3-i]isochromen-10(12H)-one |
| Research Area | Active antimalarial constituent of the tradional Chinese medicinal herb Artemisia annua L., Compositae, which has been known for almost 2000 years as Qinghao. Antimalarial. |
| Molecular Formula | C15H22O5 |
| CAS# | 63968-64-9 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@@H]1[C@@](CC[C@@H](C)[C@]2([H])CC[C@]3(C)O4)([H])[C@@]2(OO3)[C@]4([H])OC1=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30484.html |
| Additional Information | NULL |