Metoprolol succinate
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-01853 |
| Alternative Name(s) | 1-(isopropylamino)-3-(4-(2-methoxyethyl)phenoxy)propan-2-ol sccinate |
| Research Area | Metoprolol succinate is a selective adrenergic beta-1 blocking agent that is commonly used to treat ANGINA PECTORIS; HYPERTENSION; and CARDIAC ARRHYTHMIAS. |
| Molecular Formula | C15H25NO3C4H6O4 |
| CAS# | 98418-47-4 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(CCC(O)=O)=O.OC(CNC(C)C)COC1=CC=C(CCOC)C=C1.OC(CNC(C)C)COC2=CC=C(CCOC)C=C2 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO01853.html |
| Additional Information | NULL |