Lornoxicam
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-01766 |
| Alternative Name(s) | (E)-6-chloro-3-(hydroxy(pyridin-2-ylamino)methylene)-2-methyl-2H-thieno[2,3-e][1,2]thiazin-4(3H)-one 1,1-dioxide |
| Research Area | Lornoxicam (chlortenoxicam) is a new nonsteroidal anti-inflammatory drug (NSAID) of the oxicam class with analgesic, anti-inflammatory and antipyretic properties. Lornoxicam differs from other oxicam compounds in its potent inhibition of prostaglandin bio |
| Molecular Formula | C13H10ClN3O4S2 |
| CAS# | 70374-39-9 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(C(SC(Cl)=C1)=C1[S]2(=O)=O)=C(N2C)C(NC3=CC=CC=N3)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO01766.html |
| Additional Information | NULL |