Ibandronate Sodium Monohydrate
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-01683 |
| Alternative Name(s) | sodium hydrate hydrogen {1-hydroxy-3- Ibandronate Sodium Monohydrate; BM-21.0955; Bondronat; Boniva; Bonviva; Sodium Trihydrogen (1-Hydroxy-3-(methylpenthylamino)propylidene)diphosphonate Monohydrate; |
| Research Area | Ibandronate is the sodium salt form of ibandronic acid, a synthetic nitrogen-containing bisphosphonate. Ibandronic acid inhibits farnesyl pyrophosphate synthase, resulting in a reduction in geranylgeranyl GTPase signaling proteins and apoptosis of osteocl |
| Molecular Formula | C9H24NNaO8P2 |
| CAS# | 138926-19-9 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC([P](O)(O)=O)([P](O)([O-])=O)CCN(C)CCCCC.[Na+].O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO01683.html |
| Additional Information | NULL |