Risedronate sodium
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-30749 |
| Alternative Name(s) | sodium hydrogen [1-hydroxy-1-phosphono-2-(pyridin-3-yl)ethyl]phosphonate |
| Research Area | Risedronate sodium is an aminobisphosphonate derivative of etidronic acid and CALCIUM CHANNEL BLOCKER that inhibits BONE RESORPTION and is used for the treatment of OSTEOPOROSIS. |
| Molecular Formula | C7H10NNaO7P2 |
| CAS# | 115436-72-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC([P](O)(O)=O)([P](O)([O-])=O)CC1=CN=CC=C1.[Na+] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30749.html |
| Additional Information | NULL |