Isoxsuprine Hydrochloride
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-01667 |
| Alternative Name(s) | 4-{1-hydroxy-2-[(1-phenoxypropan-2- yl)amino]propyl}phenol hydrchloride |
| Research Area | Isoxsuprine is a beta-adrenergic agonist that causes direct relaxation of uterine and vascular smooth muscle. Its vasodilating actions are greater on the arteries supplying skeletal muscle than on those supplying skin. It is used in the treatment of perip |
| Molecular Formula | C18H2ClNO3 |
| CAS# | 579-56-6 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(C1=CC=C(O)C=C1)C(C)NC(C)COC2=CC=CC=C2.Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO01667.html |
| Additional Information | NULL |