Doxofylline
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-00289 |
| Alternative Name(s) | 7-((1,3-dioxolan-2-yl)methyl)-1,3-dimethyl-1H-purine-2,6(3H,7H)-dione |
| Research Area | Doxofylline is a xanthine molecule that appears to be both bronchodilator and anti-inflammatory with an improved therapeutic window over conventional xanthines such as Theophylline and the evidence supporting the effects of Doxofylline in the treatment of |
| Molecular Formula | C11H14N4O4 |
| CAS# | 69975-86-6 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(N(C)C1=O)C2=C(N1C)N=CN2CC3OCCO3 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO00289.html |
| Additional Information | NULL |