Methocarbamol
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-30645 |
| Alternative Name(s) | 2-hydroxy-3-(2-methoxyphenoxy)propylcarbamate |
| Research Area | Methocarbamol is a centrally acting muscle relaxant whose mode of action has not been established. It is used as an adjunct in the symptomatic treatment of musculoskeletal conditions associated with painful muscle spasm. |
| Molecular Formula | C11H15NO5 |
| CAS# | 0532-03-06 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(COC(N)=O)COC(C=CC=C1)=C1OC |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30645.html |
| Additional Information | NULL |