Dexketoprofen Trometamol
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-01286 |
| Alternative Name(s) | L-Ketoprofen trometamol;S-(+)-Ketoprofen Trometamol; (S)-Ketoprofen Trometamol; 2-Amino-2-(hydroxymethyl)-1,3-propanediol (aS)-3-Benzoyl-a-methylbenzenzeno-2-(hydroxymethyl)-1,3-propanediol; |
| Research Area | Dexketoprofen Trometamol is an non-steroidal anti-inflammatory drug used for the treatment of mild to moderate pain. |
| Molecular Formula | C20H25NO6 |
| CAS# | 156604-79-4 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | NC(CO)(CO)CO.O=C(C1=CC=CC=C1)C2=CC([C@H](C)C(O)=O)=CC=C2 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO01286.html |
| Additional Information | NULL |