Empagliflozin
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-11249 |
| Alternative Name(s) | (1S)-1,5-Anhydroro-3-furanyl]oxy]phenyl]methyl]phenyl]-D-I10773;JARDIANCE;UNII-HDC1R2M35U;HDC1R2M35U;BI-10773;CHEBI:82720;1-chloro-4-(glucopyranos-1-yl)-2-(4-(tetrahydrofuran-3-yloxy)benzyl)benzene;(2S,3R,4R,5S,6R)-2-(4-chloro-3-(4-(((S)-tetrahydrofuran-3 |
| Research Area | Empagliflozin is a novel, potent and selective SGLT-2 inhibitor, improves glycaemic control and features of metabolic syndrome in diabetic rats. |
| Molecular Formula | NULL |
| CAS# | 864070-44-0 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O[C@H]([C@H]1O)[C@@H](O[C@H](CO)[C@H]1O)C2=CC(CC3=CC=C(O[C@H]4CCOC4)C=C3)=C(Cl)C=C2 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO11249.html |
| Additional Information | NULL |