Pseudoephedrine Hydrochloride
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-02064 |
| Alternative Name(s) | (1S,2S)-2-(Methylamino)-1-phenylpropan-1-ol, Hydrochloride ; |
| Research Area | Pseudoephedrine Hydrochloride is the hydrochloride salt form of pseudoephedrine, a phenethylamine and an diastereomer of ephedrine with sympathomimetic property. Pseudoephedrine hydrochloride displaces norepinephrine from storage vesicles in presynaptic n |
| Molecular Formula | C10H16ClNO |
| CAS# | 345-78-8 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O[C@@H](C1=CC=CC=C1)[C@H](C)NC.Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02064.html |
| Additional Information | NULL |