Fusidic Acid
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-01526 |
| Alternative Name(s) | (Z)-2-((3R,4S,5S,8S,9S,10S,11R,13R,14S,16S)-16-acetoxy-3,11-dihydroxy-4,8,10,14-tetramethyldodecahydro-1H-cyclopenta[a]phenanthren-17(2H,10H,14H)-ylidene)-6-methylhept-5-enoic acid |
| Research Area | Fusidic acid is a bacteriostatic antibiotic. Fusidic Acid suppresses nitric oxide lysis of pancreatic islet cells. Inhibits protein synthesis in prokaryotes by inhibiting the ribosome-dependent activity of G factor and translocation of peptidyl-tRNA. |
| Molecular Formula | C31H48O6 |
| CAS# | NULL |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@@]([C@]([C@H](O)C1)([H])[C@]2(CC[C@H]3O)C)(CC[C@@]2([H])[C@@H]3C)[C@]([C@]1([H])/C4=C(C(O)=O)CC/C=C(C)C)(C[C@@H]4OC(C)=O)C |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO01526.html |
| Additional Information | NULL |