Cefradine
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-30547 |
| Alternative Name(s) | (6R,7R)-7-[[(2R)-2-amino-2-(1,4-cyclohexadien-1-yl)acetyl]amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic Acid; 7-[D-α-Amino-(1,4-cyclohexadienyl)acetamide]-3-desacetoxycephalosphoranic Acid; Anspor; Cefradex; Cefradin; Cefradine; Cefrag; Cefro; Celex; Cephradin; Cesporan; Dimacef; Easkacef; Ecosporina; Eskacef; Lenzacef; Lisacef; Megacef; SQ 11436; Samedrin; Sefril; Velocef; Velosef; |
| Research Area | Cephradine is a first generation cephalosporin antibiotic. Cephradine has broad spectrum of bactericidal activity against infections caused by Streptococcus, Staphylococcus, Diplococcus pneumoniae, Escherichia, Klebsiella, Salmonella, and indole-negative 9 |
| Molecular Formula | C16H19N3O4S |
| CAS# | 38821-53-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C1N(C(C(O)=O)=C(C)CS2)[C@@]2([H])[C@@H]1NC([C@@H](C3=CCC=CC3)N)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30547.html |
| Additional Information | NULL |
