Sulfacetamide Sodium
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-13354 |
| Alternative Name(s) | NULL |
| Research Area | An antibiotic that blocks synthesis of dihydrofolic acid by inhibiting the enzyme dihydropteroate synthase |
| Molecular Formula | C8H9N2NaO3S |
| CAS# | 127-56-0 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=[S]([N-]C(C)=O)(C1=CC=C(N)C=C1)=O.[Na+] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO13354.html |
| Additional Information | NULL |