Theophylline anhydrous
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-30795 |
| Alternative Name(s) | NULL |
| Research Area | A methyl xanthine derivative from tea with diuretic, smooth muscle relaxant, bronchial dilation, cardiac and central nervous system stimulant activities. Theophylline inhibits the 3',5'-CYCLIC NUCLEOTIDE PHOSPHODIESTERASE that degrades CYCLIC AMP thus pot |
| Molecular Formula | C7H8N4O2 |
| CAS# | 58-55-9 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(N1C)C(N=CN2)=C2N(C)C1=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30795.html |
| Additional Information | NULL |