Aprepitant
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-11601 |
| Alternative Name(s) | 5-[[(2R,3S)-2-[(1R)-1-[3,5-Bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)-4-morpholinyl]methyl]-1,2-dihydro-3H-1,2,4-triazol-3-one; Fosaprepitant Dimeglumine Impurity C |
| Research Area | A novel selective neurokinin-1 (NK-1) receptor antagonist. In vitro studies using human liver microsomes indicate that Aprepitant is metabolised primarily by CYP3A4 with minor metabolism by CYP1A2 and CYP2C19, and no metabolism by CYP2D6, CYP2C9, or CYP2E1. Antiemetic. |
| Molecular Formula | C23H21F7N4O3 |
| CAS# | 170729-80-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C1NC(CN(CCO2)[C@@H](C3=CC=C(F)C=C3)[C@H]2O[C@@H](C4=CC(C(F)(F)F)=CC(C(F)(F)F)=C4)C)=NN1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO11601.html |
| Additional Information | NULL |