Phenindione
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-30634 |
| Alternative Name(s) | 2-Phenyl-1,3-indandione ;2-Phenyl-1,3-indandione; |
| Research Area | Phenindione is a proton pump inhibitor and traditional nonsteroidal anti-inflammatory drug used for acute interstitial nephritis and acute kidney injury. |
| Molecular Formula | C15H10O2 |
| CAS# | 83-12-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(C1=C2C=CC=C1)C(C3=CC=CC=C3)C2=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30634.html |
| Additional Information | NULL |