Canagliflozin
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-10825 |
| Alternative Name(s) | (1S)-1,5-Anhydroyl]methyl]-4-methylphenyl]-D-(4-fluorophenyl)thiophen-2-yl)methyl)-4-methylphenyl)-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4,5-triol; Canagliflozin; 842133-18-0; Invokana; TA 7284; UNII-6S49DGR869; CHEBI:73274 |
| Research Area | Canagliflozin belongs to a new class of anti-diabetic drugs that works by inhibiting the sodium-glucose transport protein (SGLT2). This transport protein is found in the kidney and is responsible for reabsorbing glucose that has been filtered. |
| Molecular Formula | NULL |
| CAS# | 842133-18-0 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O[C@H]1[C@H](C2=CC(CC3=CC=C(C4=CC=C(F)C=C4)S3)=C(C)C=C2)O[C@H](CO)[C@@H](O)[C@@H]1O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO10825.html |
| Additional Information | NULL |