Oxaliplatin
API Standard
| Trivial name | NULL |
| Catalog Number | CS-M-58281 |
| Alternative Name(s) | NULL |
| Research Area | Oxaliplatin is third generation platinum complex. An antitumor agent with activity against colorectal cancer. Cytotoxicity follows the formation of adducts with DNA. Antineoplastic. |
| Molecular Formula | C8H14N2O4Pt |
| CAS# | 61825-94-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C1[O-][Pt+2]2([NH2][C@@](CCCC3)([H])[C@]3([H])[NH2]2)[O-]C1=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSM58281.html |
| Additional Information | NULL |