Pilocarpic Acid Sodium Salt
API Standard
| Catalog Number | CS-T-60582 |
| Alternative Name(s) | Pilocarpic Acid Sodium Salt;[S-(R*,S*)]-a-Ethyl-ß-(hydroxymethyl)-1-methyl-1H-Imidazole-5-butam Salt; Sodium Pilocarpate; Pilocarpic acid sodium salt is mixture of Pilocarpic acid and Isopilocarpic acid (81:19) |
| Research Area | An imidazole derivative used in the preparation of novel sequentially labile pilocarpine prodrugs for improved ocular delivery. |
| Molecular Formula | C11H17N2NaO3 |
| CAS# | 92598-79-3 |
| Purity | >98% |
| SMILES | OC[C@H](CC1=CN=CN1C)[C@H](CC)C(O)=O.[NaH] |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST60582.html |