Pemetrexed Disodium
API Standard
| Catalog Number | CS-O-31001 |
| Alternative Name(s) | D-Pemetrexed disodium;(D)-Pemetrexed;(2R)-2-[[[4-[2-(2-amino-4-oxo-4,7-dihydro-1H-pyrrolo[2,3-d]pyrimidin-5-yl)ethyl]phenyl]carbonyl]amino]pentanedioic acid;Pemetrexed R-Isomer;Pemetrexed EP Impurity E Disodium salt |
| Research Area | Pemetrexed is a novel antifolate and antimetabolite for TS, DHFR and GARFT with Ki of 1.3 nM, 7.2 nM and 65 nM, respectively |
| Molecular Formula | C20H19N5Na2O6 |
| CAS# | 937370-10-0 |
| Purity | >98% |
| SMILES | O=C1C2=C(NC(N)=N1)NC=C2CCC3=CC=C(C(N[C@@H](C([O-])=O)CCC([O-])=O)=O)C=C3.[Na+].[Na+] |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO31001.html |