Naphazoline hydrochloride
API Standard
| Catalog Number | CS-O-30990 |
| Alternative Name(s) | 2-(naphthalen-1-ylmethyl)-4,5-dihydro-1H-imidazole hydrochloride |
| Research Area | Naphazoline Hydrochloride is the hydrochloride salt form of naphazoline, an imidazole derivative and a direct-acting sympathomimetic amine with vasoconstrictive properties. Upon ocular administration, naphazoline hydrochloride exerts its effect by acting |
| Molecular Formula | C14H15ClN2 |
| CAS# | 550-99-2 |
| Purity | >98% |
| SMILES | C1(CC2=NCCN2)=CC=CC3=CC=CC=C13.Cl |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30990.html |