Deltamethrin
API Standard
| Catalog Number | CS-O-30901 |
| Alternative Name(s) | (1R,3R)-3-(2,2-Dibromoethenyl)-2,2-dimethylcyclopropanecarboxylic Acid (S)-cyano(3-phenoxyphenyl)methyl Ester; Decamethrin; Esbecythrin; FMC-45498; NRDC-161; |
| Research Area | Synthetic pyrethroid insecticide, which acts as a potent inhibitor of calcineurin (protein phosphatase 2B) and has an IC50 of about 100pM. This inhibition action results in cellular hyperexcitability by causing non-mutated calcium channels to remain open for an extended period of time allowing an abundance of Ca2+ to enter the cell. |
| Molecular Formula | C₂₂H₁₉Br₂NO₃ |
| CAS# | 52918-63-5 |
| Purity | >98% |
| SMILES | O=C([C@@H]1[C@H](/C=C(Br)/Br)C1(C)C)O[C@@H](C2=CC(OC3=CC=CC=C3)=CC=C2)C#N |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30901.html |