Tiropramide Hydrochloride
API Standard
| Catalog Number | CS-O-30801 |
| Alternative Name(s) | Alfospas; Maiorad; TiroMid |
| Research Area | Tiropramide is an antispasmodic agent. Studies sugges that Tiropramide has a pure musculotropic smooth muscle relaxant activity. Tiropramide is considered to be useful to inhibit the contractile response of the urinary bladder. |
| Molecular Formula | C28H41N3O3.Cl |
| CAS# | 53567-47-8 |
| Purity | >98% |
| SMILES | O=C(N(CCC)CCC)C(NC(C1=CC=CC=C1)=O)CC2=CC=C(OCCN(CC)CC)C=C2.Cl |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30801.html |