Ticagrelor
API Standard
| Catalog Number | CS-O-30794 |
| Research Area | Ticagrelor is a P2Y12 Platelet Inhibitor. The mechanism of action of is as a Phenylalanine Hydroxylase Activator, and P2Y12 Receptor Antagonist, and Cytochrome P450 3A4 Inhibitor, and Cytochrome P450 3A5 Inhibitor, and P-Glycoprotein Inhibitor. The physio |
| Molecular Formula | C23H28F2N6O4S |
| CAS# | 274693-27-5 |
| Purity | >98% |
| SMILES | FC1=C(F)C=CC([C@H]2[C@@H](C2)NC3=C(N=NN4[C@@H]5C[C@H](OCCO)[C@@H](O)[C@H]5O)C4=NC(SCCC)=N3)=C1 |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30794.html |