Pitavastatin Calcium
API Standard
| Catalog Number | CS-O-30720 |
| Research Area | Pitavastatin Calcium is a calcium salt formulation of pitavastatin, a novel statin that induces plaque regression and elevates HDL-cholesterol levels.Pitavastatin a lipid-lowering agent that belongs to the statin class of medications for treatment of dysl |
| Molecular Formula | C50H4CaF2N2O8 |
| CAS# | 147526-32-7 |
| Purity | >98% |
| SMILES | O[C@@H](C[C@@H](O)CC([O-])=O)/C=C/C1=C(C2=CC=C(F)C=C2)C(C=CC=C3)=C3N=C1C4CC4.O[C@@H](C[C@@H](O)CC([O-])=O)/C=C/C5=C(C6=CC=C(F)C=C6)C(C=CC=C7)=C7N=C5C8CC8.[Ca+2] |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30720.html |