Nilutamide
API Standard
| Catalog Number | CS-O-30698 |
| Alternative Name(s) | Nilutamide;Nilandron; Anandron; |
| Research Area | Nilutamide is a synthetic, nonsteroidal agent with antiandrogenic properties. Nilutamide preferentially binds to androgen receptors and blocks androgen receptor activation by testosterone and other androgens; this agent may inhibit androgen-dependent grow |
| Molecular Formula | C12H10F3N3O4 |
| CAS# | 63612-50-0 |
| Purity | >98% |
| SMILES | O=C(C(C)(N1)C)N(C2=CC(C(F)(F)F)=C([N+]([O-])=O)C=C2)C1=O |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30698.html |