Nateglinide
API Standard
| Catalog Number | CS-O-30674 |
| Alternative Name(s) | (2R)-3-phenyl-2-{[4-(propan-2- d |
| Research Area | Nateglinide is a phenylalanine derivative of the meglitinide class of agents with hypoglycemic activity. Nateglinide, compared to repaglitinide, binds with a higher affinity to the SUR1 subunit and with a faster onset of action and a shorter duration of a |
| Molecular Formula | C19H27NO3 |
| CAS# | 105816-04-4 |
| Purity | >98% |
| SMILES | O=C([C@H]1CC[C@H](C(C)C)CC1)N[C@@H](C(O)=O)CC2=CC=CC=C2 |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30674.html |