Memantine Hydrochloride
API Standard
| Catalog Number | CS-O-30638 |
| Alternative Name(s) | Memantine HCL; 3,5-dimethyladamantan-1-amine hydrochloride; |
| Research Area | Memantine Hydrochloride is the hydrochloride salt of memantine, a low-affinity, voltage-dependent, noncompetitive N-methyl-D-aspartate (NMDA) receptor antagonist. Memantine binds to and inhibits cation channels of glutamanergic NMDA receptors located in t |
| Molecular Formula | C12H21N . Cl |
| CAS# | 41100-52-1 |
| Purity | >98% |
| SMILES | C[C@](C[C@](N)(C1)C2)(C[C@@H]1C3)C[C@]23C.Cl |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30638.html |