Imipramine Hydrochloride
API Standard
| Catalog Number | CS-O-30600 |
| Alternative Name(s) | Chrytemin;Imiprin;10,11-Dihydro-N,N-dimethyl-5H-dibenz[b,f]azepine-5-propanamine hydrchloride, 5-[3-(Dimethylamino)propyl]-10,11-dihydro-5H-dibenz[b,f]azepine hydrchloride |
| Research Area | Imipramine hydrochloride is the prototypical tricyclic antidepressant. It has been used in major depression, dysthymia, bipolar depression, attention-deficit disorders, agoraphobia, and panic disorders. It has less sedative effect than some other members |
| Molecular Formula | C19H24N2 . Cl |
| CAS# | 113-52-0 |
| Purity | >98% |
| SMILES | CN(C)CCCN1C2=CC=CC=C2CCC3=C1C=CC=C3.Cl |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30600.html |