Fluorometholone
API Standard
| Catalog Number | CS-O-30583 |
| Alternative Name(s) | 11β,17α-Dihydroxy-9-fluoro-6-methyl-1,4-pregnadiene-3,20-dione |
| Research Area | Fluorometholone is a synthetic glucocorticoid with anti-inflammatory and anti-allergic properties. Fluorometholone exerts its effects by interacting with cytoplasmic glucocorticoid receptors and subsequently activates glucocorticoid receptor mediated gene |
| Molecular Formula | C22H29FO4 |
| CAS# | 426-13-1 |
| Purity | >98% |
| SMILES | F[C@@]1([C@]2(C=C3)C)[C@](C[C@H](C)C2=CC3=O)([H])[C@@](CC[C@]4(O)C(C)=O)([H])[C@]4(C)C[C@@H]1O |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30583.html |