Saquinavir Mesylate
API Standard
| Catalog Number | CS-O-30496 |
| Alternative Name(s) | (2S)-N1[(1S,2R)-3-[(3S,4aS,8aS)-3-[[(1,1-Dimethylethyl)aminocarbonyl]ctahydro-2-(1H)-isoquinolinyl]-2-hydroxy-1-(phenylmethyl)propyl]-2-[(2-quinolinycarbonyl)amino]butanediamide Mesylate; Fortovase; Invirase; Ro 31-8959 |
| Research Area | Saquinavir mesylate is an HIV protease inhibitor which acts as an analog of an HIV protease cleavage site. It is a highly specific inhibitor of HIV-1 and HIV-2 proteases, and also inhibits CYTOCHROME P-450 CYP3A. |
| Molecular Formula | C39H54N6O8S |
| CAS# | 149845-06-7 |
| Purity | >98% |
| SMILES | C[S](=O)(O)=O.O[C@@H]([C@@H](NC([C@H](CC(N)=O)NC(C1=NC2=CC=CC=C2C=C1)=O)=O)CC3=CC=CC=C3)CN(C[C@](CCCC4)([H])[C@]4([H])C5)[C@@H]5C(NC(C)(C)C)=O |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30496.html |
