Zotepine
API Standard
| Catalog Number | CS-O-11774 |
| Alternative Name(s) | 2-[xy]-N,N-dimethylethanamine |
| Research Area | Zotepine, is an atypical antipsychotic drug used for the treatment of acute and chronic schizophrenia, and acute bipolar mania. It acts as antagonist at dopamine and serotonin receptors. It has a high affinity for the D1 and D2 receptors. |
| Molecular Formula | C18H18ClNOS |
| CAS# | 26615-21-4 |
| Purity | >98% |
| SMILES | CN(C)CCOC1=CC(C=CC=C2)=C2SC3=CC=C(Cl)C=C13 |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO11774.html |