Zonisamide
API Standard
| Catalog Number | CS-O-11773 |
| Alternative Name(s) | 1,2-Benzisoxazole-3-methanesulfonamide; CS-O-30842; 3-(Sulfamoylmethyl)-1,2-benzisoxazole |
| Research Area | Sulfonamide antiseizure agent; blocks repetitive firing of voltagesensitive sodium channels and reduces voltage-sensitive T-type calcium currents. Heterocyclic methanesulfonide with anticonvulsant properties. The compound is under investigation for potential therapeutic use as an antiepileptic drug. Anticonvulsant. |
| Molecular Formula | C8H8N2O3S |
| CAS# | 68291-97-4 |
| Purity | >98% |
| SMILES | N[S](CC1=NOC2=CC=CC=C12)(=O)=O |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO11773.html |