Zoledronic acid
API Standard
| Catalog Number | CS-O-11771 |
| Alternative Name(s) | P,P'-[1-Hydroxy-2-(1H-imidazol-1-yl)ethylidene]bis-phosphonic Acid |
| Research Area | Zoledronic acid induces apoptosis in osteoclasts by inhibiting enzymes of the mevalonate pathway and preventing the isoprenylation of small GTP-binding proteins such as Ras and Rho. |
| Molecular Formula | C5H10N2O7P2 |
| CAS# | 118072-93-8 |
| Purity | >98% |
| SMILES | OC([P](O)(O)=O)(CN1C=CN=C1)[P](O)(O)=O |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO11771.html |