Quinapril Hydrochloride
API Standard
| Catalog Number | CS-O-10225 |
| Alternative Name(s) | (3S)-2-[(2S)-2-{[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino}propanoyl]-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid hydrochloride |
| Research Area | Quinapril is the hydrochloride salt form of quinapril, a prodrug and non-sulfhydryl angiotensin converting enzyme (ACE) inhibitor with antihypertensive activity. Quinapril is hydrolized into its active form quinaprilat, which binds to and inhibits ACE, th |
| Molecular Formula | C25H31ClN2O5 |
| CAS# | 82586-55-8 |
| Purity | >98% |
| SMILES | O=C(N(CC1=CC=CC=C1C2)[C@@H]2C(O)=O)[C@H](C)N[C@H](C(OCC)=O)CCC3=CC=CC=C3.Cl |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO10225.html |
