Tranylcypromine Hydrochloride
API Standard
| Catalog Number | CS-O-10189 |
| Alternative Name(s) | Trans-2-Phenylcyclopropylamine hydrochloride ;Tranylcypromine ; |
| Research Area | Tranylcypromine is a monoamine oxidase inhibitor, which inhibits CYP2A6 with Ki of 0.08 M and 0.2 M in cDNA-expressing microsomes and Human Liver Microsomes, respectively. |
| Molecular Formula | C9H12ClN |
| CAS# | 1986-47-6 |
| Purity | >98% |
| SMILES | N[C@H]1[C@H](C2=CC=CC=C2)C1.Cl |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO10189.html |