Cholesterol
API Standard
| Catalog Number | CS-O-06238 |
| Alternative Name(s) | (3β)-cholest-5-en-3-ol;(10R,13R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol, Cholesterin, Cholesteryl alcohol [1] 2,15-dimethyl-14-(1,5-dimethylhexyl)tetracyclo[8.7.0.02,7.011,15]heptadec-7-en-5-ol |
| Research Area | Cholesterol is a major component of all biological membranes; ~25% of total brain lipid is Cholesterol. Cholesterol is the principal sterol of the higher animals. Cholesterol was found in all body tissues, especial in the brain, spinal cord, and in animal |
| Molecular Formula | C27H46O |
| CAS# | 57-88-5 |
| Purity | >98% |
| SMILES | C[C@@]1([C@@]2([H])[C@H](C)CCCC(C)C)[C@](CC2)([H])[C@@](CC=C3[C@@]4(CC[C@H](O)C3)C)([H])[C@]4([H])CC1 |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06238.html |
