Testosterone Enanthate
API Standard
| Catalog Number | CS-O-05333 |
| Alternative Name(s) | (17β)-17-[(1-Oxoheptyl)oxy]androst-4-en-3-one, 17β-Hydroxy-4-androsten-3-one 17-enanthate, 4-Androsten-17β-ol-3-one 17-enanthate, Nc 17591, Testosterone 17β-heptanoate, |
| Research Area | Testosterone Enanthate is a long-acting intramuscular form of the androgen testosterone. Testosterone inhibits gonadotropin secretion from the pituitary gland and ablates estrogen production in the ovaries, thereby decreasing endogenous estrogen levels. I |
| Molecular Formula | C26H40O3 |
| CAS# | 315-37-7 |
| Purity | >98% |
| SMILES | C[C@@](C(CC1)=CC2=O)(CC2)[C@]3([H])[C@]1([H])[C@@](CC[C@@H]4OC(CCCCCC)=O)([H])[C@]4(C)CC3 |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO05333.html |