Vecuronium bromide
API Standard
| Catalog Number | CS-O-02580 |
| Alternative Name(s) | 1-((2S,3S,5S,8R,9S,10S,13S,14S,16S,17R)-3,17-diacetoxy-10,13-dimethyl-2-(piperidin-1-yl)hexadecahydro-1H-cyclopenta[a]phenanthren-16-yl)-1-methylpiperidin-1-ium bromide |
| Research Area | Vecuronium Bromide is the bromide salt form of vecuronium, a synthetic steroid derivative of the naturally occurring alkaloids of curare with a muscle relaxant property. Vecuronium bromide competes with acetylcholine for the nicotinic receptors at the neu |
| Molecular Formula | C34H57BrN2O4 |
| CAS# | 50700-72-6 |
| Purity | >98% |
| SMILES | C[C@@]1([C@H]2OC(C)=O)[C@](C[C@@H]2[N+]3(CCCCC3)C)([H])[C@@](CC[C@]4([H])[C@@]5(C[C@H](N6CCCCC6)[C@@H](OC(C)=O)C4)C)([H])[C@]5([H])CC1.[Br-] |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02580.html |