Vinpocetine
API Standard
| Catalog Number | CS-O-02572 |
| Alternative Name(s) | (41S,13aS)-ethyl 13a-ethyl-2,3,41,5,6,13a-hexahydro-1H-indolo[3,2,1-de]pyrido[3,2,1-ij][1,5]naphthyridine-12-carboxylate |
| Research Area | Vinpocetine is reported to have cerebral blood-flow enhancing and neuroprotective effects, and is used as a drug for the treatment of cerebrovascular disorders and age-related memory impairment. |
| Molecular Formula | C22H26N2O2 |
| CAS# | 42971-09-05 |
| Purity | >98% |
| SMILES | CC[C@@]1(CCCN2CC3)[C@@]2([H])C4=C3C5=CC=CC=C5N4C(C(OCC)=O)=C1 |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02572.html |