Vorinostat
API Standard
| Catalog Number | CS-O-02570 |
| Alternative Name(s) | N1-hydroxy-N8-phenoylanilide hydroxlohydroxamc cid;suberoylanilide hydroxamc cid;Suberanilohydroxamc cid;N-hydroxy-N'-phenylctanediamide SAHAcpd;ctanediamide, N-hydroxy-N'-phenyl- cCRIS 8456;cTANEDIOc cID HYDROXYAMIDE PHENYLAMIDE;Vorinostat MSD;UNII-58IFB293JI |
| Research Area | Vorinostat (rINN) or suberoylanilide hydroxamic acid (SAHA), is a drug currently under investigation for the treatment of cutaneous T cell lymphoma (CTCL), a type of skin cancer. |
| Molecular Formula | C14H20N2O3 |
| CAS# | 149647-78-9 |
| Purity | >98% |
| SMILES | O=C(CCCCCCC(NO)=O)NC1=CC=CC=C1 |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02570.html |
