Voglibose
API Standard
| Catalog Number | CS-O-02553 |
| Alternative Name(s) | (1S,2S,3R,4S,5S)-5-((1,3-dihydroxypropan-2-yl)amino)-1-(hydroxymethyl)cyclohexane-1,2,3,4-tetraol |
| Research Area | Voglibose is a valiolamine derivative and inhibitor of alpha-glucosidase with antihyperglycemic activity. Voglibose binds to and inhibits alpha-glucosidase, an enteric enzyme found in the brush border of the small intestines that hydrolyzes oligosaccharid |
| Molecular Formula | C10H21NO7 |
| CAS# | 83480-29-9 |
| Purity | >98% |
| SMILES | OCC(CO)N[C@H]([C@@H]([C@@H](O)[C@@H]1O)O)C[C@]1(O)CO |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02553.html |
