Triptorelin Acetate
API Standard
| Catalog Number | CS-O-02531 |
| Alternative Name(s) | 5-Oxo-L-prolyl-L-histidyl-L-tryptophyl-L-seryl-L-tyrosyl-D-tryptophyl-L-leucyl-L-arginyl-L-prolylglycinamide acetate |
| Research Area | TRIPTORELIN is a potent synthetic long-acting agonist of GONADOTROPIN-RELEASING HORMONE with D-tryptophan substitution at residue 6. Triptorelin is a synthetic decapeptide agonist analog of luteinizing hormone releasing hormone (LHRH). Possessing greater |
| Molecular Formula | C66H86N18O15 |
| CAS# | 140194-24-7 |
| Purity | >98% |
| SMILES | CC(O)=O.O=C(N[C@@H](CC(C)C)C(N[C@@H](CCCNC(N)=N)C(N(CCC1)[C@@H]1C(NCC(N)=O)=O)=O)=O)[C@H](NC([C@@H](NC([C@H](CO)NC([C@@H](NC([C@@H](NC([C@H](CC2)NC2=O)=O)CC3=CNC=N3)=O)CC4=CNC5=C4C=CC=C5)=O)=O)CC6=CC=C(O)C=C6)=O)CC7=CNC8=C7C=CC=C8 |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02531.html |