Tenofovir Disoproxil
API Standard
| Catalog Number | CS-O-02506 |
| Research Area | Tenofovir disoproxil is an adenine analog REVERSE TRANSCRIPTASE INHIBITOR with antiviral activity against HIV-1 and HEPATITIS B. It is used to treat HIV INFECTIONS and CHRONIC HEPATITIS B, in combination with other ANTIVIRAL AGENTS, due to the emergence o |
| Molecular Formula | C19H30N5O10P |
| CAS# | 201341-05-1 |
| Purity | >98% |
| SMILES | C[C@@H](OC[P](OCOC(OC(C)C)=O)(OCOC(OC(C)C)=O)=O)CN1C(N=CN=C2N)=C2N=C1 |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02506.html |