Tiotropium bromide
API Standard
| Catalog Number | CS-O-02442 |
| Alternative Name(s) | (2R,4S,7s)-7-(2-hydroxy-2,2-di(thiophen-2-]nonan-9-ium bromide; CS-C-01218 |
| Research Area | Tiotropium Bromide is the bromide salt form of tiotropium, a quaternary ammonium derivative of atropine and a muscarinic receptor antagonist, with bronchodilating activity. Although it does not display selectivity for specific muscarinic receptors, on top |
| Molecular Formula | C19H22BrNO4S2 |
| CAS# | 136310-93-5 |
| Purity | >98% |
| SMILES | OC(C1=CC=CS1)(C2=CC=CS2)C(O[C@H]3C[C@H]([N+]4(C)C)[C@H](O5)[C@H]5[C@H]4C3)=O.[Br-] |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02442.html |