Tirofiban Hydrochloride
API Standard
| Catalog Number | CS-O-02440 |
| Alternative Name(s) | Tirofiban hydrchloride; 142373-60-2; (S)-2-(butylsulfonamino)-3-(4-[4-(piperidin-4-yl)butoxy]phenyl) propanoic acid monohydrochloride |
| Research Area | Tirofiban Hydrochloride is the hydrochloride salt form of tirofiban, a non-peptide tyrosine derivative with anticoagulant property. Tirofiban antagonizes fibrinogen binding to the platelet cell surface receptor, glycoprotein (GP) IIb/IIIA complex, one of |
| Molecular Formula | C22H37ClN2O5S |
| CAS# | 150915-40-5 |
| Purity | >98% |
| SMILES | OC([C@@H](N[S](CCCC)(=O)=O)CC1=CC=C(OCCCCC2CCNCC2)C=C1)=O.Cl.O |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02440.html |