Sertraline
API Standard
| Catalog Number | CS-O-02347 |
| Alternative Name(s) | (1S,4S)-4-(3,4etrahydronaphthalen-1-amine |
| Research Area | Sertraline is an antidepressant in a group of drugs called selective serotonin reuptake inhibitors (SSRIs). Sertraline is used to treat depression, obsessive-compulsive disorder, panic disorder, anxiety disorders, post-traumatic stress disorder (PTSD), an |
| Molecular Formula | C17H1Cl2N |
| CAS# | 79617-96-2 |
| Purity | >98% |
| SMILES | CN[C@@H]1C2=CC=CC=C2[C@H](C3=CC(Cl)=C(Cl)C=C3)CC1 |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02347.html |
