Ramelteon
API Standard
| Catalog Number | CS-O-02264 |
| Alternative Name(s) | (S)-N-(2-(2,6,7,8-tetrahydro-1H-indeno[5,4-b]furan-8-yl)ethyl)propionamide. |
| Research Area | Ramelteon is a synthetic melatonin analogue with hypnotic and circadian rhythm-modulating activities. Ramelteon binds to and activates melatonin receptors 1 and 2 in the suprachiasmatic nucleus (SCN) of the brain, thereby promoting the onset of sleep. Unl |
| Molecular Formula | C16H21NO2 |
| CAS# | 196597-26-9 |
| Purity | >98% |
| SMILES | O=C(CC)NCC[C@H]1C(C(CCO2)=C2C=C3)=C3CC1 |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02264.html |